C25H25NO4 — CID 3114107
pentyl 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate (PubChem CID 3114107) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is pentyl 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate.
| Compound Name | pentyl 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate |
|---|---|
| PubChem CID | 3114107 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | pentyl 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate |
| SMILES | CCCCCOC(=O)CN1C(=O)C2C3c4ccccc4C(c4ccccc43)C2C1=O |
| InChI | InChI=1S/C25H25NO4/c1-2-3-8-13-30-19(27)14-26-24(28)22-20-15-9-4-5-10-16(15)21(23(22)25(26)29)18-12-7-6-11-17(18)20/h4-7,9-12,20-23H,2-3,8,13-14H2,1H3 |
| InChIKey | OPGOPYLQRUWVDM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|