C29H23NO6 — CID 3121315
[2-(4-methoxyphenyl)-2-oxoethyl] 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate (PubChem CID 3121315) has the molecular formula C29H23NO6 and a molecular weight of 481.50 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate |
|---|---|
| PubChem CID | 3121315 |
| Molecular Formula | C29H23NO6 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate |
| SMILES | COc1ccc(C(=O)COC(=O)CN2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C29H23NO6/c1-35-17-12-10-16(11-13-17)22(31)15-36-23(32)14-30-28(33)26-24-18-6-2-3-7-19(18)25(27(26)29(30)34)21-9-5-4-8-20(21)24/h2-13,24-27H,14-15H2,1H3 |
| InChIKey | DTHDFECHWCMDOZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|