C28H31NO4 — CID 3119407
octyl 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate (PubChem CID 3119407) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is octyl 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate.
| Compound Name | octyl 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate |
|---|---|
| PubChem CID | 3119407 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | octyl 2-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)acetate |
| SMILES | CCCCCCCCOC(=O)CN1C(=O)C2C3c4ccccc4C(c4ccccc43)C2C1=O |
| InChI | InChI=1S/C28H31NO4/c1-2-3-4-5-6-11-16-33-22(30)17-29-27(31)25-23-18-12-7-8-13-19(18)24(26(25)28(29)32)21-15-10-9-14-20(21)23/h7-10,12-15,23-26H,2-6,11,16-17H2,1H3 |
| InChIKey | BPUZJMFUQNRCTP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|