C31H29NO4 — CID 41039218
[4-(2-methylbutan-2-yl)phenyl] 2-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]acetate (PubChem CID 41039218) has the molecular formula C31H29NO4 and a molecular weight of 479.58 g/mol. Its IUPAC name is [4-(2-methylbutan-2-yl)phenyl] 2-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]acetate.
| Compound Name | [4-(2-methylbutan-2-yl)phenyl] 2-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]acetate |
|---|---|
| PubChem CID | 41039218 |
| Molecular Formula | C31H29NO4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [4-(2-methylbutan-2-yl)phenyl] 2-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]acetate |
| SMILES | CCC(C)(C)c1ccc(OC(=O)CN2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C31H29NO4/c1-4-31(2,3)18-13-15-19(16-14-18)36-24(33)17-32-29(34)27-25-20-9-5-6-10-21(20)26(28(27)30(32)35)23-12-8-7-11-22(23)25/h5-16,25-28H,4,17H2,1-3H3/t25?,26?,27-,28-/m1/s1 |
| InChIKey | YWEHNQBBQNNDEQ-XQOSCOKLSA-N |
| XLogP | 5.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|