C22H27NO4 — CID 98234325
[4-(2-methylbutan-2-yl)phenyl] 2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate (PubChem CID 98234325) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [4-(2-methylbutan-2-yl)phenyl] 2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate.
| Compound Name | [4-(2-methylbutan-2-yl)phenyl] 2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
|---|---|
| PubChem CID | 98234325 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [4-(2-methylbutan-2-yl)phenyl] 2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
| SMILES | CCC(C)(C)c1ccc(OC(=O)CN2C(=O)[C@@H]3[C@H]4CC[C@@H](C4)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-4-22(2,3)15-7-9-16(10-8-15)27-17(24)12-23-20(25)18-13-5-6-14(11-13)19(18)21(23)26/h7-10,13-14,18-19H,4-6,11-12H2,1-3H3/t13-,14-,18+,19+/m0/s1 |
| InChIKey | ABBRWYMDBINZAO-YXUGBTPSSA-N |
| XLogP | 3.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|