C24H27NO4 — CID 23197943
[4-(2-methylbutan-2-yl)phenyl] 2-[(1S,2R,6S,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate (PubChem CID 23197943) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is [4-(2-methylbutan-2-yl)phenyl] 2-[(1S,2R,6S,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate.
| Compound Name | [4-(2-methylbutan-2-yl)phenyl] 2-[(1S,2R,6S,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate |
|---|---|
| PubChem CID | 23197943 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [4-(2-methylbutan-2-yl)phenyl] 2-[(1S,2R,6S,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate |
| SMILES | CCC(C)(C)c1ccc(OC(=O)CN2C(=O)[C@@H]3[C@H]4C=C[C@H]([C@H]5C[C@@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C24H27NO4/c1-4-24(2,3)13-5-7-14(8-6-13)29-19(26)12-25-22(27)20-15-9-10-16(18-11-17(15)18)21(20)23(25)28/h5-10,15-18,20-21H,4,11-12H2,1-3H3/t15-,16+,17-,18+,20+,21- |
| InChIKey | MFNYRBDYWVKIDE-MIAOPUFOSA-N |
| XLogP | 3.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|