C30H35NO4 — CID 3114101
hexyl 6-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)hexanoate (PubChem CID 3114101) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is hexyl 6-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)hexanoate.
| Compound Name | hexyl 6-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)hexanoate |
|---|---|
| PubChem CID | 3114101 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | hexyl 6-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)hexanoate |
| SMILES | CCCCCCOC(=O)CCCCCN1C(=O)C2C3c4ccccc4C(c4ccccc43)C2C1=O |
| InChI | InChI=1S/C30H35NO4/c1-2-3-4-12-19-35-24(32)17-6-5-11-18-31-29(33)27-25-20-13-7-8-14-21(20)26(28(27)30(31)34)23-16-10-9-15-22(23)25/h7-10,13-16,25-28H,2-6,11-12,17-19H2,1H3 |
| InChIKey | GGLPRZAWNPLQJN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|