C13H16N4O3 — CID 114531068
2-(1-methylimidazol-2-yl)ethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate (PubChem CID 114531068) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)ethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate.
| Compound Name | 2-(1-methylimidazol-2-yl)ethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 114531068 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)ethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate |
| SMILES | Cn1ccnc1CCOC(=O)Cn1cc(N)ccc1=O |
| InChI | InChI=1S/C13H16N4O3/c1-16-6-5-15-11(16)4-7-20-13(19)9-17-8-10(14)2-3-12(17)18/h2-3,5-6,8H,4,7,9,14H2,1H3 |
| InChIKey | ABSNIWZACIMMKC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |