C15H15N3O3 — CID 114531043
2-(1-methylimidazol-2-yl)ethyl 5-amino-1-benzofuran-2-carboxylate (PubChem CID 114531043) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)ethyl 5-amino-1-benzofuran-2-carboxylate.
| Compound Name | 2-(1-methylimidazol-2-yl)ethyl 5-amino-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 114531043 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)ethyl 5-amino-1-benzofuran-2-carboxylate |
| SMILES | Cn1ccnc1CCOC(=O)c1cc2cc(N)ccc2o1 |
| InChI | InChI=1S/C15H15N3O3/c1-18-6-5-17-14(18)4-7-20-15(19)13-9-10-8-11(16)2-3-12(10)21-13/h2-3,5-6,8-9H,4,7,16H2,1H3 |
| InChIKey | GBFOOYOLNHATNJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|