C13H14N4OS — CID 114531096
2-[2-(1-methylimidazol-2-yl)ethylsulfanyl]-1,3-benzoxazol-6-amine (PubChem CID 114531096) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-[2-(1-methylimidazol-2-yl)ethylsulfanyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[2-(1-methylimidazol-2-yl)ethylsulfanyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 114531096 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-[2-(1-methylimidazol-2-yl)ethylsulfanyl]-1,3-benzoxazol-6-amine |
| SMILES | Cn1ccnc1CCSc1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C13H14N4OS/c1-17-6-5-15-12(17)4-7-19-13-16-10-3-2-9(14)8-11(10)18-13/h2-3,5-6,8H,4,7,14H2,1H3 |
| InChIKey | RUOQYBHRDCCQCN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|