C11H11N3OS — CID 61358286
4-[(6-amino-1,3-benzoxazol-2-yl)sulfanyl]butanenitrile (PubChem CID 61358286) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 4-[(6-amino-1,3-benzoxazol-2-yl)sulfanyl]butanenitrile.
| Compound Name | 4-[(6-amino-1,3-benzoxazol-2-yl)sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 61358286 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-[(6-amino-1,3-benzoxazol-2-yl)sulfanyl]butanenitrile |
| SMILES | N#CCCCSc1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C11H11N3OS/c12-5-1-2-6-16-11-14-9-4-3-8(13)7-10(9)15-11/h3-4,7H,1-2,6,13H2 |
| InChIKey | DTTKGJPZCZGLHG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|