C10H10N2OS — CID 130507814
2-prop-2-enylsulfanyl-1,3-benzoxazol-6-amine (PubChem CID 130507814) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-1,3-benzoxazol-6-amine.
| Compound Name | 2-prop-2-enylsulfanyl-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 130507814 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-prop-2-enylsulfanyl-1,3-benzoxazol-6-amine |
| SMILES | C=CCSc1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C10H10N2OS/c1-2-5-14-10-12-8-4-3-7(11)6-9(8)13-10/h2-4,6H,1,5,11H2 |
| InChIKey | NQFBRIRTAFCKOV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|