C15H13N3O2S — CID 61359052
4-[(6-amino-1,3-benzoxazol-2-yl)sulfanylmethyl]benzamide (PubChem CID 61359052) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 4-[(6-amino-1,3-benzoxazol-2-yl)sulfanylmethyl]benzamide.
| Compound Name | 4-[(6-amino-1,3-benzoxazol-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 61359052 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-[(6-amino-1,3-benzoxazol-2-yl)sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1ccc(CSc2nc3ccc(N)cc3o2)cc1 |
| InChI | InChI=1S/C15H13N3O2S/c16-11-5-6-12-13(7-11)20-15(18-12)21-8-9-1-3-10(4-2-9)14(17)19/h1-7H,8,16H2,(H2,17,19) |
| InChIKey | WBHPTMKOJIGOIE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|