C14H9ClFNOS — CID 165390800
6-chloro-2-[(4-fluorophenyl)methylsulfanyl]-1,3-benzoxazole (PubChem CID 165390800) has the molecular formula C14H9ClFNOS and a molecular weight of 293.75 g/mol. Its IUPAC name is 6-chloro-2-[(4-fluorophenyl)methylsulfanyl]-1,3-benzoxazole.
| Compound Name | 6-chloro-2-[(4-fluorophenyl)methylsulfanyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 165390800 |
| Molecular Formula | C14H9ClFNOS |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 6-chloro-2-[(4-fluorophenyl)methylsulfanyl]-1,3-benzoxazole |
| SMILES | Fc1ccc(CSc2nc3ccc(Cl)cc3o2)cc1 |
| InChI | InChI=1S/C14H9ClFNOS/c15-10-3-6-12-13(7-10)18-14(17-12)19-8-9-1-4-11(16)5-2-9/h1-7H,8H2 |
| InChIKey | GYKROEGAXDVMHN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |