C14H11N3O2 — CID 95911825
3-(6-amino-1,3-benzoxazol-2-yl)benzamide (PubChem CID 95911825) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-(6-amino-1,3-benzoxazol-2-yl)benzamide.
| Compound Name | 3-(6-amino-1,3-benzoxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 95911825 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-(6-amino-1,3-benzoxazol-2-yl)benzamide |
| SMILES | NC(=O)c1cccc(-c2nc3ccc(N)cc3o2)c1 |
| InChI | InChI=1S/C14H11N3O2/c15-10-4-5-11-12(7-10)19-14(17-11)9-3-1-2-8(6-9)13(16)18/h1-7H,15H2,(H2,16,18) |
| InChIKey | KCHFZIHOTCUJJD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|