C13H10N2O2 — CID 131880958
3-(5-amino-1,3-benzoxazol-2-yl)phenol (PubChem CID 131880958) has the molecular formula C13H10N2O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 3-(5-amino-1,3-benzoxazol-2-yl)phenol.
| Compound Name | 3-(5-amino-1,3-benzoxazol-2-yl)phenol |
|---|---|
| PubChem CID | 131880958 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3-(5-amino-1,3-benzoxazol-2-yl)phenol |
| SMILES | Nc1ccc2oc(-c3cccc(O)c3)nc2c1 |
| InChI | InChI=1S/C13H10N2O2/c14-9-4-5-12-11(7-9)15-13(17-12)8-2-1-3-10(16)6-8/h1-7,16H,14H2 |
| InChIKey | PIGFFBLYKJFDFZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|