C13H12N3O+ — CID 100817959
2-(1-methylpyridin-1-ium-3-yl)-1,3-benzoxazol-6-amine (PubChem CID 100817959) has the molecular formula C13H12N3O+ and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-(1-methylpyridin-1-ium-3-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(1-methylpyridin-1-ium-3-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 100817959 |
| Molecular Formula | C13H12N3O+ |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(1-methylpyridin-1-ium-3-yl)-1,3-benzoxazol-6-amine |
| SMILES | C[n+]1cccc(-c2nc3ccc(N)cc3o2)c1 |
| InChI | InChI=1S/C13H12N3O/c1-16-6-2-3-9(8-16)13-15-11-5-4-10(14)7-12(11)17-13/h2-8H,14H2,1H3/q+1 |
| InChIKey | IFDQCAZHTHBNEF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|