C11H8N2O2 — CID 43117917
2-(furan-2-yl)-1,3-benzoxazol-6-amine (PubChem CID 43117917) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 2-(furan-2-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(furan-2-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 43117917 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(furan-2-yl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(-c3ccco3)oc2c1 |
| InChI | InChI=1S/C11H8N2O2/c12-7-3-4-8-10(6-7)15-11(13-8)9-2-1-5-14-9/h1-6H,12H2 |
| InChIKey | GRGWURKBLCMONT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|