C11H9N3O2 — CID 96611710
2-(5-methyl-1,3-oxazol-2-yl)-1,3-benzoxazol-6-amine (PubChem CID 96611710) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-(5-methyl-1,3-oxazol-2-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(5-methyl-1,3-oxazol-2-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 96611710 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-(5-methyl-1,3-oxazol-2-yl)-1,3-benzoxazol-6-amine |
| SMILES | Cc1cnc(-c2nc3ccc(N)cc3o2)o1 |
| InChI | InChI=1S/C11H9N3O2/c1-6-5-13-10(15-6)11-14-8-3-2-7(12)4-9(8)16-11/h2-5H,12H2,1H3 |
| InChIKey | JKZZKWFPLUHNJQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|