C11H12N2O2 — CID 82469943
3-methoxy-4-(5-methyl-1,3-oxazol-2-yl)aniline (PubChem CID 82469943) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-methoxy-4-(5-methyl-1,3-oxazol-2-yl)aniline.
| Compound Name | 3-methoxy-4-(5-methyl-1,3-oxazol-2-yl)aniline |
|---|---|
| PubChem CID | 82469943 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-methoxy-4-(5-methyl-1,3-oxazol-2-yl)aniline |
| SMILES | COc1cc(N)ccc1-c1ncc(C)o1 |
| InChI | InChI=1S/C11H12N2O2/c1-7-6-13-11(15-7)9-4-3-8(12)5-10(9)14-2/h3-6H,12H2,1-2H3 |
| InChIKey | BRRAHCVTEJXISS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|