C13H11N3O3 — CID 107209217
4-[3-(furan-3-yl)-1,2,4-oxadiazol-5-yl]-3-methoxyaniline (PubChem CID 107209217) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-[3-(furan-3-yl)-1,2,4-oxadiazol-5-yl]-3-methoxyaniline.
| Compound Name | 4-[3-(furan-3-yl)-1,2,4-oxadiazol-5-yl]-3-methoxyaniline |
|---|---|
| PubChem CID | 107209217 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-[3-(furan-3-yl)-1,2,4-oxadiazol-5-yl]-3-methoxyaniline |
| SMILES | COc1cc(N)ccc1-c1nc(-c2ccoc2)no1 |
| InChI | InChI=1S/C13H11N3O3/c1-17-11-6-9(14)2-3-10(11)13-15-12(16-19-13)8-4-5-18-7-8/h2-7H,14H2,1H3 |
| InChIKey | YXXUJYWNTLSMOM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|