C18H18N2O5 — CID 912387
3-(4-methoxyphenyl)-5-(2,4,5-trimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 912387) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-(2,4,5-trimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-methoxyphenyl)-5-(2,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 912387 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-(2,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(-c3cc(OC)c(OC)cc3OC)n2)cc1 |
| InChI | InChI=1S/C18H18N2O5/c1-21-12-7-5-11(6-8-12)17-19-18(25-20-17)13-9-15(23-3)16(24-4)10-14(13)22-2/h5-10H,1-4H3 |
| InChIKey | VYIGYFWMDYSSPR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |