C15H14N4O2 — CID 107811619
5-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine (PubChem CID 107811619) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine.
| Compound Name | 5-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811619 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 5-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine |
| SMILES | COc1ccccc1-c1noc(-c2cc(N)cc(N)c2)n1 |
| InChI | InChI=1S/C15H14N4O2/c1-20-13-5-3-2-4-12(13)14-18-15(21-19-14)9-6-10(16)8-11(17)7-9/h2-8H,16-17H2,1H3 |
| InChIKey | XSECOPZTNLVXBX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|