C9H10N4O2 — CID 62594321
[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]hydrazine (PubChem CID 62594321) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is [3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]hydrazine.
| Compound Name | [3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 62594321 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | [3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]hydrazine |
| SMILES | COc1ccccc1-c1noc(NN)n1 |
| InChI | InChI=1S/C9H10N4O2/c1-14-7-5-3-2-4-6(7)8-11-9(12-10)15-13-8/h2-5H,10H2,1H3,(H,11,12,13) |
| InChIKey | PYVRZUFSGKMECW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|