C7H8N6O2 — CID 103375154
[3-(6-methoxypyridazin-3-yl)-1,2,4-oxadiazol-5-yl]hydrazine (PubChem CID 103375154) has the molecular formula C7H8N6O2 and a molecular weight of 208.18 g/mol. Its IUPAC name is [3-(6-methoxypyridazin-3-yl)-1,2,4-oxadiazol-5-yl]hydrazine.
| Compound Name | [3-(6-methoxypyridazin-3-yl)-1,2,4-oxadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 103375154 |
| Molecular Formula | C7H8N6O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | [3-(6-methoxypyridazin-3-yl)-1,2,4-oxadiazol-5-yl]hydrazine |
| SMILES | COc1ccc(-c2noc(NN)n2)nn1 |
| InChI | InChI=1S/C7H8N6O2/c1-14-5-3-2-4(11-12-5)6-9-7(10-8)15-13-6/h2-3H,8H2,1H3,(H,9,10,13) |
| InChIKey | XVRNHMDHZSRAQL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|