C10H8N2O3 — CID 63773034
3-(2-methoxyphenyl)-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 63773034) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1,2,4-oxadiazole-5-carbaldehyde.
| Compound Name | 3-(2-methoxyphenyl)-1,2,4-oxadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63773034 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-(2-methoxyphenyl)-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | COc1ccccc1-c1noc(C=O)n1 |
| InChI | InChI=1S/C10H8N2O3/c1-14-8-5-3-2-4-7(8)10-11-9(6-13)15-12-10/h2-6H,1H3 |
| InChIKey | XDPJROVEYHSRDI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|