C10H11N3O3 — CID 63691181
5-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-amine (PubChem CID 63691181) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 63691181 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-amine |
| SMILES | COc1ccc(-c2nc(N)no2)c(OC)c1 |
| InChI | InChI=1S/C10H11N3O3/c1-14-6-3-4-7(8(5-6)15-2)9-12-10(11)13-16-9/h3-5H,1-2H3,(H2,11,13) |
| InChIKey | XXGZOCHIFQJJJP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |