C13H11N5O2 — CID 115411776
5-methoxy-2-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 115411776) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 5-methoxy-2-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | 5-methoxy-2-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 115411776 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-methoxy-2-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | COc1ccc(-c2nc(-c3ncccn3)no2)c(N)c1 |
| InChI | InChI=1S/C13H11N5O2/c1-19-8-3-4-9(10(14)7-8)13-17-12(18-20-13)11-15-5-2-6-16-11/h2-7H,14H2,1H3 |
| InChIKey | AIPSVNOYZBIQOP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|