C15H19N3O3 — CID 63026122
5-(2,4-dimethoxyphenyl)-3-piperidin-3-yl-1,2,4-oxadiazole (PubChem CID 63026122) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-3-piperidin-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2,4-dimethoxyphenyl)-3-piperidin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63026122 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-3-piperidin-3-yl-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2nc(C3CCCNC3)no2)c(OC)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-19-11-5-6-12(13(8-11)20-2)15-17-14(18-21-15)10-4-3-7-16-9-10/h5-6,8,10,16H,3-4,7,9H2,1-2H3 |
| InChIKey | WYLMPZUTCJRYDQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |