C13H15N3O — CID 86326580
5-phenyl-3-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole (PubChem CID 86326580) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 5-phenyl-3-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-phenyl-3-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 86326580 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-phenyl-3-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2nc([C@@H]3CCCNC3)no2)cc1 |
| InChI | InChI=1S/C13H15N3O/c1-2-5-10(6-3-1)13-15-12(16-17-13)11-7-4-8-14-9-11/h1-3,5-6,11,14H,4,7-9H2/t11-/m1/s1 |
| InChIKey | RFNUNTOBFIYXAW-LLVKDONJSA-N |
| XLogP | 2.20 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |