C13H13Cl2N3O — CID 63026121
5-(2,6-dichlorophenyl)-3-piperidin-3-yl-1,2,4-oxadiazole (PubChem CID 63026121) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-3-piperidin-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2,6-dichlorophenyl)-3-piperidin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63026121 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-3-piperidin-3-yl-1,2,4-oxadiazole |
| SMILES | Clc1cccc(Cl)c1-c1nc(C2CCCNC2)no1 |
| InChI | InChI=1S/C13H13Cl2N3O/c14-9-4-1-5-10(15)11(9)13-17-12(18-19-13)8-3-2-6-16-7-8/h1,4-5,8,16H,2-3,6-7H2 |
| InChIKey | ADPVXYGLNHHIMQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |