C12H16Cl2N4O — CID 68962118
3-piperidin-3-yl-5-pyridin-2-yl-1,2,4-oxadiazole;dihydrochloride (PubChem CID 68962118) has the molecular formula C12H16Cl2N4O and a molecular weight of 303.19 g/mol. Its IUPAC name is 3-piperidin-3-yl-5-pyridin-2-yl-1,2,4-oxadiazole;dihydrochloride.
| Compound Name | 3-piperidin-3-yl-5-pyridin-2-yl-1,2,4-oxadiazole;dihydrochloride |
|---|---|
| PubChem CID | 68962118 |
| Molecular Formula | C12H16Cl2N4O |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-piperidin-3-yl-5-pyridin-2-yl-1,2,4-oxadiazole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2nc(C3CCCNC3)no2)nc1 |
| InChI | InChI=1S/C12H14N4O.2ClH/c1-2-7-14-10(5-1)12-15-11(16-17-12)9-4-3-6-13-8-9;;/h1-2,5,7,9,13H,3-4,6,8H2;2*1H |
| InChIKey | DWZAHUICDSIEAC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |