C11H12N4O — CID 99727844
5-pyridin-2-yl-3-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazole (PubChem CID 99727844) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 5-pyridin-2-yl-3-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-pyridin-2-yl-3-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 99727844 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 5-pyridin-2-yl-3-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2nc([C@@H]3CCNC3)no2)nc1 |
| InChI | InChI=1S/C11H12N4O/c1-2-5-13-9(3-1)11-14-10(15-16-11)8-4-6-12-7-8/h1-3,5,8,12H,4,6-7H2/t8-/m1/s1 |
| InChIKey | WMOAUNZXFBADQD-MRVPVSSYSA-N |
| XLogP | 1.21 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |