C12H10Cl2N2O2 — CID 72866103
5-(2,6-dichlorophenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole (PubChem CID 72866103) has the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.13 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(2,6-dichlorophenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 72866103 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-3-(oxolan-3-yl)-1,2,4-oxadiazole |
| SMILES | Clc1cccc(Cl)c1-c1nc(C2CCOC2)no1 |
| InChI | InChI=1S/C12H10Cl2N2O2/c13-8-2-1-3-9(14)10(8)12-15-11(16-18-12)7-4-5-17-6-7/h1-3,7H,4-6H2 |
| InChIKey | AOYJLGUNNCMYAG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |