C16H19N3O2 — CID 97455442
3-[(3R)-oxolan-3-yl]-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole (PubChem CID 97455442) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-[(3R)-oxolan-3-yl]-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-[(3R)-oxolan-3-yl]-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97455442 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-[(3R)-oxolan-3-yl]-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole |
| SMILES | c1cc(N2CCCC2)ccc1-c1nc([C@H]2CCOC2)no1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-9-19(8-1)14-5-3-12(4-6-14)16-17-15(18-21-16)13-7-10-20-11-13/h3-6,13H,1-2,7-11H2/t13-/m0/s1 |
| InChIKey | YKJJAVRLQSGBJE-ZDUSSCGKSA-N |
| XLogP | 2.84 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |