C11H12N4O2 — CID 65329882
5-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine (PubChem CID 65329882) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine.
| Compound Name | 5-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 65329882 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2nc(C3CCOC3)no2)cn1 |
| InChI | InChI=1S/C11H12N4O2/c12-9-2-1-7(5-13-9)11-14-10(15-17-11)8-3-4-16-6-8/h1-2,5,8H,3-4,6H2,(H2,12,13) |
| InChIKey | PZNVOSWFYPKAFJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |