C9H11N5O2 — CID 65330662
5-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]-1H-pyrazol-3-amine (PubChem CID 65330662) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 5-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]-1H-pyrazol-3-amine.
| Compound Name | 5-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 65330662 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 5-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]-1H-pyrazol-3-amine |
| SMILES | Nc1cc(-c2nc(C3CCOC3)no2)[nH]n1 |
| InChI | InChI=1S/C9H11N5O2/c10-7-3-6(12-13-7)9-11-8(14-16-9)5-1-2-15-4-5/h3,5H,1-2,4H2,(H3,10,12,13) |
| InChIKey | AEBFEZMGCKCZFE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |