About 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine
5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine (PubChem CID 80620090) has the molecular formula C12H14N4OS
and a molecular weight of 262.34 g/mol. Its IUPAC name is 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
| PubChem CID | 80620090 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2nc(C3CCCCS3)no2)cn1 |
| InChI | InChI=1S/C12H14N4OS/c13-10-5-4-8(7-14-10)12-15-11(16-17-12)9-3-1-2-6-18-9/h4-5,7,9H,1-3,6H2,(H2,13,14) |
| InChIKey | XGFBRWXCRZSHDP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine?
The IUPAC name of 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine (CID 80620090) is 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine.
What is the SMILES notation for 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine?
The canonical SMILES for 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine is Nc1ccc(-c2nc(C3CCCCS3)no2)cn1.
What is the InChIKey of 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine?
The InChIKey is XGFBRWXCRZSHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4OS/c13-10-5-4-8(7-14-10)12-15-11(16-17-12)9-3-1-2-6-18-9/h4-5,7,9H,1-3,6H2,(H2,13,14).
What are the key properties of 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine?
5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine has a molecular weight of 262.34 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine is sourced from PubChem (CID 80620090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).