C12H12N2O3S — CID 107706860
5-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol (PubChem CID 107706860) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 5-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol.
| Compound Name | 5-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107706860 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(-c2nc(C3CCCS3)no2)c1 |
| InChI | InChI=1S/C12H12N2O3S/c15-8-4-7(5-9(16)6-8)12-13-11(14-17-12)10-2-1-3-18-10/h4-6,10,15-16H,1-3H2 |
| InChIKey | NCIGSHXLJZAXNY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |