About 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile
6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile (PubChem CID 167827506) has the molecular formula C18H15N3OS
and a molecular weight of 321.41 g/mol. Its IUPAC name is 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile |
| PubChem CID | 167827506 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile |
| SMILES | N#Cc1ccc2cc(-c3nc(C4CCCCS4)no3)ccc2c1 |
| InChI | InChI=1S/C18H15N3OS/c19-11-12-4-5-14-10-15(7-6-13(14)9-12)18-20-17(21-22-18)16-3-1-2-8-23-16/h4-7,9-10,16H,1-3,8H2 |
| InChIKey | PUIGUIAYEYKOHT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile?
The IUPAC name of 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile (CID 167827506) is 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile.
What is the SMILES notation for 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile?
The canonical SMILES for 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile is N#Cc1ccc2cc(-c3nc(C4CCCCS4)no3)ccc2c1.
What is the InChIKey of 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile?
The InChIKey is PUIGUIAYEYKOHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3OS/c19-11-12-4-5-14-10-15(7-6-13(14)9-12)18-20-17(21-22-18)16-3-1-2-8-23-16/h4-7,9-10,16H,1-3,8H2.
What are the key properties of 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile?
6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile has a molecular weight of 321.41 g/mol, XLogP of 4.72, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile is sourced from PubChem (CID 167827506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).