C18H15N3OS — CID 167827506
6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile (PubChem CID 167827506) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile.
| Compound Name | 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 167827506 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 6-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]naphthalene-2-carbonitrile |
| SMILES | N#Cc1ccc2cc(-c3nc(C4CCCCS4)no3)ccc2c1 |
| InChI | InChI=1S/C18H15N3OS/c19-11-12-4-5-14-10-15(7-6-13(14)9-12)18-20-17(21-22-18)16-3-1-2-8-23-16/h4-7,9-10,16H,1-3,8H2 |
| InChIKey | PUIGUIAYEYKOHT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |