C12H13N3O2S — CID 136872316
2-amino-4-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136872316) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-amino-4-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-4-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136872316 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-amino-4-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Nc1cc(-c2nc(C3CCCS3)no2)ccc1O |
| InChI | InChI=1S/C12H13N3O2S/c13-8-6-7(3-4-9(8)16)12-14-11(15-17-12)10-2-1-5-18-10/h3-4,6,10,16H,1-2,5,13H2 |
| InChIKey | OZDOUCUIMJPJJW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|