C13H14ClN3OS — CID 80620097
2-chloro-4-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 80620097) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 2-chloro-4-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-chloro-4-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 80620097 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-chloro-4-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1ccc(-c2nc(C3CCCCS3)no2)cc1Cl |
| InChI | InChI=1S/C13H14ClN3OS/c14-9-7-8(4-5-10(9)15)13-16-12(17-18-13)11-3-1-2-6-19-11/h4-5,7,11H,1-3,6,15H2 |
| InChIKey | GWNREXIDMUSNBQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|