C8H7ClN4O — CID 65416842
5-(4-amino-3-chlorophenyl)-1,2,4-oxadiazol-3-amine (PubChem CID 65416842) has the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. Its IUPAC name is 5-(4-amino-3-chlorophenyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(4-amino-3-chlorophenyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 65416842 |
| Molecular Formula | C8H7ClN4O |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 5-(4-amino-3-chlorophenyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(-c2ccc(N)c(Cl)c2)n1 |
| InChI | InChI=1S/C8H7ClN4O/c9-5-3-4(1-2-6(5)10)7-12-8(11)13-14-7/h1-3H,10H2,(H2,11,13) |
| InChIKey | JXPLMKPLOZKXOE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|