C14H18ClN3O2 — CID 116703123
2-chloro-4-[3-(1-ethoxy-2-methylpropyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 116703123) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-chloro-4-[3-(1-ethoxy-2-methylpropyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-chloro-4-[3-(1-ethoxy-2-methylpropyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 116703123 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-chloro-4-[3-(1-ethoxy-2-methylpropyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CCOC(c1noc(-c2ccc(N)c(Cl)c2)n1)C(C)C |
| InChI | InChI=1S/C14H18ClN3O2/c1-4-19-12(8(2)3)13-17-14(20-18-13)9-5-6-11(16)10(15)7-9/h5-8,12H,4,16H2,1-3H3 |
| InChIKey | ZWXMSAPXPDUKEZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|