About 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine
5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine (PubChem CID 65417275) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine |
| PubChem CID | 65417275 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1cccc(-c2nc(N)no2)c1 |
| InChI | InChI=1S/C8H8N4O/c9-6-3-1-2-5(4-6)7-11-8(10)12-13-7/h1-4H,9H2,(H2,10,12) |
| InChIKey | OEXOAEHNEBOBRR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine (CID 65417275) is 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine is Nc1cccc(-c2nc(N)no2)c1.
What is the InChIKey of 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine?
The InChIKey is OEXOAEHNEBOBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O/c9-6-3-1-2-5(4-6)7-11-8(10)12-13-7/h1-4H,9H2,(H2,10,12).
What are the key properties of 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine?
5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine has a molecular weight of 176.18 g/mol, XLogP of 0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 65417275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).