C8H8N4O — CID 65417275
5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine (PubChem CID 65417275) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 65417275 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5-(3-aminophenyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1cccc(-c2nc(N)no2)c1 |
| InChI | InChI=1S/C8H8N4O/c9-6-3-1-2-5(4-6)7-11-8(10)12-13-7/h1-4H,9H2,(H2,10,12) |
| InChIKey | OEXOAEHNEBOBRR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|