C8H6N4O3 — CID 63692611
5-(3-nitrophenyl)-1,2,4-oxadiazol-3-amine (PubChem CID 63692611) has the molecular formula C8H6N4O3 and a molecular weight of 206.16 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(3-nitrophenyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 63692611 |
| Molecular Formula | C8H6N4O3 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 5-(3-nitrophenyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C8H6N4O3/c9-8-10-7(15-11-8)5-2-1-3-6(4-5)12(13)14/h1-4H,(H2,9,11) |
| InChIKey | CQDUFRLOXZDXNR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|