C14H13N7O5 — CID 10642187
2-[2,6-diamino-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrimidin-4-yl]oxyethanol (PubChem CID 10642187) has the molecular formula C14H13N7O5 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-[2,6-diamino-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrimidin-4-yl]oxyethanol.
| Compound Name | 2-[2,6-diamino-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrimidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 10642187 |
| Molecular Formula | C14H13N7O5 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[2,6-diamino-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrimidin-4-yl]oxyethanol |
| SMILES | Nc1nc(N)c(-c2nc(-c3cccc([N+](=O)[O-])c3)no2)c(OCCO)n1 |
| InChI | InChI=1S/C14H13N7O5/c15-10-9(12(25-5-4-22)19-14(16)17-10)13-18-11(20-26-13)7-2-1-3-8(6-7)21(23)24/h1-3,6,22H,4-5H2,(H4,15,16,17,19) |
| InChIKey | FIZRMCWRHZNBDM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 189.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|