C12H7N3O4 — CID 699740
5-(furan-2-yl)-3-(3-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 699740) has the molecular formula C12H7N3O4 and a molecular weight of 257.21 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-(3-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(furan-2-yl)-3-(3-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 699740 |
| Molecular Formula | C12H7N3O4 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 5-(furan-2-yl)-3-(3-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2noc(-c3ccco3)n2)c1 |
| InChI | InChI=1S/C12H7N3O4/c16-15(17)9-4-1-3-8(7-9)11-13-12(19-14-11)10-5-2-6-18-10/h1-7H |
| InChIKey | ZYYUAFAEJZYDNR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|