C17H15N3O — CID 65415115
3-[3-(2,3-dihydro-1H-inden-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 65415115) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1H-inden-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3-[3-(2,3-dihydro-1H-inden-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 65415115 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-[3-(2,3-dihydro-1H-inden-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1cccc(-c2nc(C3Cc4ccccc4C3)no2)c1 |
| InChI | InChI=1S/C17H15N3O/c18-15-7-3-6-13(10-15)17-19-16(20-21-17)14-8-11-4-1-2-5-12(11)9-14/h1-7,10,14H,8-9,18H2 |
| InChIKey | KCRXCNGBOPVDBO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|