C12H11FN2O2S — CID 136827660
3-fluoro-4-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136827660) has the molecular formula C12H11FN2O2S and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-fluoro-4-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 3-fluoro-4-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136827660 |
| Molecular Formula | C12H11FN2O2S |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-fluoro-4-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Oc1ccc(-c2nc(C3CCCS3)no2)c(F)c1 |
| InChI | InChI=1S/C12H11FN2O2S/c13-9-6-7(16)3-4-8(9)12-14-11(15-17-12)10-2-1-5-18-10/h3-4,6,10,16H,1-2,5H2 |
| InChIKey | OJGNOKKGFVDAED-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |